C15H9F3I2N2O2 — CID 137066625
N-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]-3-(trifluoromethyl)benzamide (PubChem CID 137066625) has the molecular formula C15H9F3I2N2O2 and a molecular weight of 560.05 g/mol. Its IUPAC name is N-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 137066625 |
| Molecular Formula | C15H9F3I2N2O2 |
| Molecular Weight | 560.05 g/mol |
| Exact Mass | 559.87 |
| IUPAC Name | N-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(N/N=C\c1cc(I)cc(I)c1O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H9F3I2N2O2/c16-15(17,18)10-3-1-2-8(4-10)14(24)22-21-7-9-5-11(19)6-12(20)13(9)23/h1-7,23H,(H,22,24)/b21-7- |
| InChIKey | NPRCXNVYRUPOFY-YXSASFKJSA-N |
| XLogP | 4.38 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.05 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|