C14H9ClI2N2O2 — CID 137066622
2-chloro-N-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]benzamide (PubChem CID 137066622) has the molecular formula C14H9ClI2N2O2 and a molecular weight of 526.50 g/mol. Its IUPAC name is 2-chloro-N-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]benzamide.
| Compound Name | 2-chloro-N-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 137066622 |
| Molecular Formula | C14H9ClI2N2O2 |
| Molecular Weight | 526.50 g/mol |
| Exact Mass | 525.84 |
| IUPAC Name | 2-chloro-N-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1cc(I)cc(I)c1O)c1ccccc1Cl |
| InChI | InChI=1S/C14H9ClI2N2O2/c15-11-4-2-1-3-10(11)14(21)19-18-7-8-5-9(16)6-12(17)13(8)20/h1-7,20H,(H,19,21)/b18-7- |
| InChIKey | QHTTWEGCNWDDSL-WSVATBPTSA-N |
| XLogP | 4.02 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.50 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|