C14H9Cl2IN2O2 — CID 615778
N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-iodobenzamide (PubChem CID 615778) has the molecular formula C14H9Cl2IN2O2 and a molecular weight of 435.05 g/mol. Its IUPAC name is N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-iodobenzamide.
| Compound Name | N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-iodobenzamide |
|---|---|
| PubChem CID | 615778 |
| Molecular Formula | C14H9Cl2IN2O2 |
| Molecular Weight | 435.05 g/mol |
| Exact Mass | 433.91 |
| IUPAC Name | N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-iodobenzamide |
| SMILES | O=C(NN=Cc1cc(Cl)cc(Cl)c1O)c1ccccc1I |
| InChI | InChI=1S/C14H9Cl2IN2O2/c15-9-5-8(13(20)11(16)6-9)7-18-19-14(21)10-3-1-2-4-12(10)17/h1-7,20H,(H,19,21) |
| InChIKey | ZODRBVVXZVJGEN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.05 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|