C28H22Cl4CuN4O6+4 — CID 50910310
copper bis([2,4-dichloro-6-[[(2-hydroxybenzoyl)hydrazinylidene]methyl]phenyl]oxidanium) (PubChem CID 50910310) has the molecular formula C28H22Cl4CuN4O6+4 and a molecular weight of 715.86 g/mol. Its IUPAC name is copper bis([2,4-dichloro-6-[[(2-hydroxybenzoyl)hydrazinylidene]methyl]phenyl]oxidanium).
| Compound Name | copper bis([2,4-dichloro-6-[[(2-hydroxybenzoyl)hydrazinylidene]methyl]phenyl]oxidanium) |
|---|---|
| PubChem CID | 50910310 |
| Molecular Formula | C28H22Cl4CuN4O6+4 |
| Molecular Weight | 715.86 g/mol |
| Exact Mass | 712.96 |
| IUPAC Name | copper bis([2,4-dichloro-6-[[(2-hydroxybenzoyl)hydrazinylidene]methyl]phenyl]oxidanium) |
| SMILES | O=C(NN=Cc1cc(Cl)cc(Cl)c1[OH2+])c1ccccc1O.O=C(NN=Cc1cc(Cl)cc(Cl)c1[OH2+])c1ccccc1O.[Cu+2] |
| InChI | InChI=1S/2C14H10Cl2N2O3.Cu/c2*15-9-5-8(13(20)11(16)6-9)7-17-18-14(21)10-3-1-2-4-12(10)19;/h2*1-7,19-20H,(H,18,21);/q;;+2/p+2 |
| InChIKey | YVROQYVQEJQOGT-UHFFFAOYSA-P |
| XLogP | 5.80 |
| TPSA | 169.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.86 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|