C14H10Cl2N2O3 — CID 137095074
N-[(3,4-dichloro-2-hydroxyphenyl)methylideneamino]-2-hydroxybenzamide (PubChem CID 137095074) has the molecular formula C14H10Cl2N2O3 and a molecular weight of 325.15 g/mol. Its IUPAC name is N-[(3,4-dichloro-2-hydroxyphenyl)methylideneamino]-2-hydroxybenzamide.
| Compound Name | N-[(3,4-dichloro-2-hydroxyphenyl)methylideneamino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 137095074 |
| Molecular Formula | C14H10Cl2N2O3 |
| Molecular Weight | 325.15 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | N-[(3,4-dichloro-2-hydroxyphenyl)methylideneamino]-2-hydroxybenzamide |
| SMILES | O=C(NN=Cc1ccc(Cl)c(Cl)c1O)c1ccccc1O |
| InChI | InChI=1S/C14H10Cl2N2O3/c15-10-6-5-8(13(20)12(10)16)7-17-18-14(21)9-3-1-2-4-11(9)19/h1-7,19-20H,(H,18,21) |
| InChIKey | KGKHOWBDSDURTI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.15 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|