C15H9Cl2F3N2O2 — CID 137093574
N-[(3,4-dichloro-2-hydroxyphenyl)methylideneamino]-2-(trifluoromethyl)benzamide (PubChem CID 137093574) has the molecular formula C15H9Cl2F3N2O2 and a molecular weight of 377.15 g/mol. Its IUPAC name is N-[(3,4-dichloro-2-hydroxyphenyl)methylideneamino]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[(3,4-dichloro-2-hydroxyphenyl)methylideneamino]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 137093574 |
| Molecular Formula | C15H9Cl2F3N2O2 |
| Molecular Weight | 377.15 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | N-[(3,4-dichloro-2-hydroxyphenyl)methylideneamino]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(NN=Cc1ccc(Cl)c(Cl)c1O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H9Cl2F3N2O2/c16-11-6-5-8(13(23)12(11)17)7-21-22-14(24)9-3-1-2-4-10(9)15(18,19)20/h1-7,23H,(H,22,24) |
| InChIKey | LFHWWKIFCQPLHT-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.15 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|