C15H9Cl2F3N2O — CID 4588973
3,4-dichloro-N-[[2-(trifluoromethyl)phenyl]methylideneamino]benzamide (PubChem CID 4588973) has the molecular formula C15H9Cl2F3N2O and a molecular weight of 361.15 g/mol. Its IUPAC name is 3,4-dichloro-N-[[2-(trifluoromethyl)phenyl]methylideneamino]benzamide.
| Compound Name | 3,4-dichloro-N-[[2-(trifluoromethyl)phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 4588973 |
| Molecular Formula | C15H9Cl2F3N2O |
| Molecular Weight | 361.15 g/mol |
| Exact Mass | 360.00 |
| IUPAC Name | 3,4-dichloro-N-[[2-(trifluoromethyl)phenyl]methylideneamino]benzamide |
| SMILES | O=C(NN=Cc1ccccc1C(F)(F)F)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H9Cl2F3N2O/c16-12-6-5-9(7-13(12)17)14(23)22-21-8-10-3-1-2-4-11(10)15(18,19)20/h1-8H,(H,22,23) |
| InChIKey | QEMCJTCJKKWXSS-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.15 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|