C22H14Cl2N2O — CID 6139999
N-[(Z)-anthracen-9-ylmethylideneamino]-3,4-dichlorobenzamide (PubChem CID 6139999) has the molecular formula C22H14Cl2N2O and a molecular weight of 393.27 g/mol. Its IUPAC name is N-[(Z)-anthracen-9-ylmethylideneamino]-3,4-dichlorobenzamide.
| Compound Name | N-[(Z)-anthracen-9-ylmethylideneamino]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 6139999 |
| Molecular Formula | C22H14Cl2N2O |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | N-[(Z)-anthracen-9-ylmethylideneamino]-3,4-dichlorobenzamide |
| SMILES | O=C(N/N=C\c1c2ccccc2cc2ccccc12)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H14Cl2N2O/c23-20-10-9-16(12-21(20)24)22(27)26-25-13-19-17-7-3-1-5-14(17)11-15-6-2-4-8-18(15)19/h1-13H,(H,26,27)/b25-13- |
| InChIKey | CONZVWBNSURMNH-MXAYSNPKSA-N |
| XLogP | 6.06 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|