C25H17FN4O — CID 2041756
N-(anthracen-9-ylmethylideneamino)-3-(4-fluorophenyl)-1H-pyrazole-5-carboxamide (PubChem CID 2041756) has the molecular formula C25H17FN4O and a molecular weight of 408.44 g/mol. Its IUPAC name is N-(anthracen-9-ylmethylideneamino)-3-(4-fluorophenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-(anthracen-9-ylmethylideneamino)-3-(4-fluorophenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 2041756 |
| Molecular Formula | C25H17FN4O |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | N-(anthracen-9-ylmethylideneamino)-3-(4-fluorophenyl)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NN=Cc1c2ccccc2cc2ccccc12)c1cc(-c2ccc(F)cc2)n[nH]1 |
| InChI | InChI=1S/C25H17FN4O/c26-19-11-9-16(10-12-19)23-14-24(29-28-23)25(31)30-27-15-22-20-7-3-1-5-17(20)13-18-6-2-4-8-21(18)22/h1-15H,(H,28,29)(H,30,31) |
| InChIKey | WLKZMNOPKYDHBI-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|