C29H20N4O — CID 4046792
N-(anthracen-9-ylmethylideneamino)-3-naphthalen-2-yl-1H-pyrazole-5-carboxamide (PubChem CID 4046792) has the molecular formula C29H20N4O and a molecular weight of 440.51 g/mol. Its IUPAC name is N-(anthracen-9-ylmethylideneamino)-3-naphthalen-2-yl-1H-pyrazole-5-carboxamide.
| Compound Name | N-(anthracen-9-ylmethylideneamino)-3-naphthalen-2-yl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 4046792 |
| Molecular Formula | C29H20N4O |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | N-(anthracen-9-ylmethylideneamino)-3-naphthalen-2-yl-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NN=Cc1c2ccccc2cc2ccccc12)c1cc(-c2ccc3ccccc3c2)n[nH]1 |
| InChI | InChI=1S/C29H20N4O/c34-29(28-17-27(31-32-28)23-14-13-19-7-1-2-8-20(19)15-23)33-30-18-26-24-11-5-3-9-21(24)16-22-10-4-6-12-25(22)26/h1-18H,(H,31,32)(H,33,34) |
| InChIKey | UDAPTDKUBLSQGP-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|