C32H24N4O3 — CID 135651360
N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-3-[4-(naphthalen-1-ylmethoxy)phenyl]-1H-pyrazole-5-carboxamide (PubChem CID 135651360) has the molecular formula C32H24N4O3 and a molecular weight of 512.57 g/mol. Its IUPAC name is N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-3-[4-(naphthalen-1-ylmethoxy)phenyl]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-3-[4-(naphthalen-1-ylmethoxy)phenyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 135651360 |
| Molecular Formula | C32H24N4O3 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-3-[4-(naphthalen-1-ylmethoxy)phenyl]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(N/N=C/c1c(O)ccc2ccccc12)c1cc(-c2ccc(OCc3cccc4ccccc34)cc2)n[nH]1 |
| InChI | InChI=1S/C32H24N4O3/c37-31-17-14-22-7-2-4-11-27(22)28(31)19-33-36-32(38)30-18-29(34-35-30)23-12-15-25(16-13-23)39-20-24-9-5-8-21-6-1-3-10-26(21)24/h1-19,37H,20H2,(H,34,35)(H,36,38)/b33-19+ |
| InChIKey | IUSDAYSJLVVOAZ-HNSNBQBZSA-N |
| XLogP | 6.43 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|