C24H17Cl2FN4O2 — CID 5133908
N-[(2-chloro-6-fluorophenyl)methylideneamino]-3-[4-[(2-chlorophenyl)methoxy]phenyl]-1H-pyrazole-5-carboxamide (PubChem CID 5133908) has the molecular formula C24H17Cl2FN4O2 and a molecular weight of 483.33 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methylideneamino]-3-[4-[(2-chlorophenyl)methoxy]phenyl]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(2-chloro-6-fluorophenyl)methylideneamino]-3-[4-[(2-chlorophenyl)methoxy]phenyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 5133908 |
| Molecular Formula | C24H17Cl2FN4O2 |
| Molecular Weight | 483.33 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methylideneamino]-3-[4-[(2-chlorophenyl)methoxy]phenyl]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NN=Cc1c(F)cccc1Cl)c1cc(-c2ccc(OCc3ccccc3Cl)cc2)n[nH]1 |
| InChI | InChI=1S/C24H17Cl2FN4O2/c25-19-5-2-1-4-16(19)14-33-17-10-8-15(9-11-17)22-12-23(30-29-22)24(32)31-28-13-18-20(26)6-3-7-21(18)27/h1-13H,14H2,(H,29,30)(H,31,32) |
| InChIKey | XTRVVIQALGOJFE-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.33 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|