C24H18ClFN4O2 — CID 6888331
N-[(E)-(2-chloro-6-fluorophenyl)methylideneamino]-3-(3-phenylmethoxyphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 6888331) has the molecular formula C24H18ClFN4O2 and a molecular weight of 448.89 g/mol. Its IUPAC name is N-[(E)-(2-chloro-6-fluorophenyl)methylideneamino]-3-(3-phenylmethoxyphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(E)-(2-chloro-6-fluorophenyl)methylideneamino]-3-(3-phenylmethoxyphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 6888331 |
| Molecular Formula | C24H18ClFN4O2 |
| Molecular Weight | 448.89 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | N-[(E)-(2-chloro-6-fluorophenyl)methylideneamino]-3-(3-phenylmethoxyphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(N/N=C/c1c(F)cccc1Cl)c1cc(-c2cccc(OCc3ccccc3)c2)n[nH]1 |
| InChI | InChI=1S/C24H18ClFN4O2/c25-20-10-5-11-21(26)19(20)14-27-30-24(31)23-13-22(28-29-23)17-8-4-9-18(12-17)32-15-16-6-2-1-3-7-16/h1-14H,15H2,(H,28,29)(H,30,31)/b27-14+ |
| InChIKey | MIVUFAINHXPKRI-MZJWZYIUSA-N |
| XLogP | 5.21 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.89 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|