C28H21ClN4O3 — CID 136755677
3-[3-[(2-chlorophenyl)methoxy]phenyl]-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]-1H-pyrazole-5-carboxamide (PubChem CID 136755677) has the molecular formula C28H21ClN4O3 and a molecular weight of 496.95 g/mol. Its IUPAC name is 3-[3-[(2-chlorophenyl)methoxy]phenyl]-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-[3-[(2-chlorophenyl)methoxy]phenyl]-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 136755677 |
| Molecular Formula | C28H21ClN4O3 |
| Molecular Weight | 496.95 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | 3-[3-[(2-chlorophenyl)methoxy]phenyl]-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(N/N=C\c1c(O)ccc2ccccc12)c1cc(-c2cccc(OCc3ccccc3Cl)c2)n[nH]1 |
| InChI | InChI=1S/C28H21ClN4O3/c29-24-11-4-2-7-20(24)17-36-21-9-5-8-19(14-21)25-15-26(32-31-25)28(35)33-30-16-23-22-10-3-1-6-18(22)12-13-27(23)34/h1-16,34H,17H2,(H,31,32)(H,33,35)/b30-16- |
| InChIKey | XWOVYUFPFMDOOH-UHBFCERESA-N |
| XLogP | 5.93 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.95 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|