C26H21ClN4O4 — CID 6888543
methyl 4-[(E)-[[3-[4-[(2-chlorophenyl)methoxy]phenyl]-1H-pyrazole-5-carbonyl]hydrazinylidene]methyl]benzoate (PubChem CID 6888543) has the molecular formula C26H21ClN4O4 and a molecular weight of 488.93 g/mol. Its IUPAC name is methyl 4-[(E)-[[3-[4-[(2-chlorophenyl)methoxy]phenyl]-1H-pyrazole-5-carbonyl]hydrazinylidene]methyl]benzoate.
| Compound Name | methyl 4-[(E)-[[3-[4-[(2-chlorophenyl)methoxy]phenyl]-1H-pyrazole-5-carbonyl]hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 6888543 |
| Molecular Formula | C26H21ClN4O4 |
| Molecular Weight | 488.93 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | methyl 4-[(E)-[[3-[4-[(2-chlorophenyl)methoxy]phenyl]-1H-pyrazole-5-carbonyl]hydrazinylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=N/NC(=O)c2cc(-c3ccc(OCc4ccccc4Cl)cc3)n[nH]2)cc1 |
| InChI | InChI=1S/C26H21ClN4O4/c1-34-26(33)19-8-6-17(7-9-19)15-28-31-25(32)24-14-23(29-30-24)18-10-12-21(13-11-18)35-16-20-4-2-3-5-22(20)27/h2-15H,16H2,1H3,(H,29,30)(H,31,32)/b28-15+ |
| InChIKey | DJRMLBZIHHHUQC-RWPZCVJISA-N |
| XLogP | 4.86 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.93 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|