C19H14Cl2N4O3 — CID 5445489
methyl 4-[(Z)-[[3-(2,4-dichlorophenyl)-1H-pyrazole-5-carbonyl]hydrazinylidene]methyl]benzoate (PubChem CID 5445489) has the molecular formula C19H14Cl2N4O3 and a molecular weight of 417.25 g/mol. Its IUPAC name is methyl 4-[(Z)-[[3-(2,4-dichlorophenyl)-1H-pyrazole-5-carbonyl]hydrazinylidene]methyl]benzoate.
| Compound Name | methyl 4-[(Z)-[[3-(2,4-dichlorophenyl)-1H-pyrazole-5-carbonyl]hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 5445489 |
| Molecular Formula | C19H14Cl2N4O3 |
| Molecular Weight | 417.25 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | methyl 4-[(Z)-[[3-(2,4-dichlorophenyl)-1H-pyrazole-5-carbonyl]hydrazinylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=N\NC(=O)c2cc(-c3ccc(Cl)cc3Cl)n[nH]2)cc1 |
| InChI | InChI=1S/C19H14Cl2N4O3/c1-28-19(27)12-4-2-11(3-5-12)10-22-25-18(26)17-9-16(23-24-17)14-7-6-13(20)8-15(14)21/h2-10H,1H3,(H,23,24)(H,25,26)/b22-10- |
| InChIKey | QMLIIFIPUDKXGU-YVNNLAQVSA-N |
| XLogP | 3.93 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.25 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|