C17H11Cl2N5O3 — CID 1128544
3-(2,4-dichlorophenyl)-N-[(4-nitrophenyl)methylideneamino]-1H-pyrazole-5-carboxamide (PubChem CID 1128544) has the molecular formula C17H11Cl2N5O3 and a molecular weight of 404.21 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-N-[(4-nitrophenyl)methylideneamino]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(2,4-dichlorophenyl)-N-[(4-nitrophenyl)methylideneamino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 1128544 |
| Molecular Formula | C17H11Cl2N5O3 |
| Molecular Weight | 404.21 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-N-[(4-nitrophenyl)methylideneamino]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NN=Cc1ccc([N+](=O)[O-])cc1)c1cc(-c2ccc(Cl)cc2Cl)n[nH]1 |
| InChI | InChI=1S/C17H11Cl2N5O3/c18-11-3-6-13(14(19)7-11)15-8-16(22-21-15)17(25)23-20-9-10-1-4-12(5-2-10)24(26)27/h1-9H,(H,21,22)(H,23,25) |
| InChIKey | XKEFFBCCXXFRCW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.21 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|