C26H24N4O4 — CID 6167663
N-[(Z)-[4-methoxy-3-(phenoxymethyl)phenyl]methylideneamino]-3-(4-methoxyphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 6167663) has the molecular formula C26H24N4O4 and a molecular weight of 456.50 g/mol. Its IUPAC name is N-[(Z)-[4-methoxy-3-(phenoxymethyl)phenyl]methylideneamino]-3-(4-methoxyphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(Z)-[4-methoxy-3-(phenoxymethyl)phenyl]methylideneamino]-3-(4-methoxyphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 6167663 |
| Molecular Formula | C26H24N4O4 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | N-[(Z)-[4-methoxy-3-(phenoxymethyl)phenyl]methylideneamino]-3-(4-methoxyphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)N/N=C\c3ccc(OC)c(COc4ccccc4)c3)[nH]n2)cc1 |
| InChI | InChI=1S/C26H24N4O4/c1-32-21-11-9-19(10-12-21)23-15-24(29-28-23)26(31)30-27-16-18-8-13-25(33-2)20(14-18)17-34-22-6-4-3-5-7-22/h3-16H,17H2,1-2H3,(H,28,29)(H,30,31)/b27-16- |
| InChIKey | ZYFFGRWPIYUFNM-YUMHPJSZSA-N |
| XLogP | 4.44 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|