C24H23FN2O5 — CID 4051654
N-[[3-[(4-fluorophenoxy)methyl]-4-methoxyphenyl]methylideneamino]-3,5-dimethoxybenzamide (PubChem CID 4051654) has the molecular formula C24H23FN2O5 and a molecular weight of 438.46 g/mol. Its IUPAC name is N-[[3-[(4-fluorophenoxy)methyl]-4-methoxyphenyl]methylideneamino]-3,5-dimethoxybenzamide.
| Compound Name | N-[[3-[(4-fluorophenoxy)methyl]-4-methoxyphenyl]methylideneamino]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 4051654 |
| Molecular Formula | C24H23FN2O5 |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | N-[[3-[(4-fluorophenoxy)methyl]-4-methoxyphenyl]methylideneamino]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NN=Cc2ccc(OC)c(COc3ccc(F)cc3)c2)c1 |
| InChI | InChI=1S/C24H23FN2O5/c1-29-21-11-17(12-22(13-21)30-2)24(28)27-26-14-16-4-9-23(31-3)18(10-16)15-32-20-7-5-19(25)6-8-20/h4-14H,15H2,1-3H3,(H,27,28) |
| InChIKey | MDTWQKJUUABOCS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|