C23H18F4N2O4 — CID 25237190
4-methoxy-N-[(E)-[4-methoxy-3-[(2,3,5,6-tetrafluorophenoxy)methyl]phenyl]methylideneamino]benzamide (PubChem CID 25237190) has the molecular formula C23H18F4N2O4 and a molecular weight of 462.40 g/mol. Its IUPAC name is 4-methoxy-N-[(E)-[4-methoxy-3-[(2,3,5,6-tetrafluorophenoxy)methyl]phenyl]methylideneamino]benzamide.
| Compound Name | 4-methoxy-N-[(E)-[4-methoxy-3-[(2,3,5,6-tetrafluorophenoxy)methyl]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 25237190 |
| Molecular Formula | C23H18F4N2O4 |
| Molecular Weight | 462.40 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 4-methoxy-N-[(E)-[4-methoxy-3-[(2,3,5,6-tetrafluorophenoxy)methyl]phenyl]methylideneamino]benzamide |
| SMILES | COc1ccc(C(=O)N/N=C/c2ccc(OC)c(COc3c(F)c(F)cc(F)c3F)c2)cc1 |
| InChI | InChI=1S/C23H18F4N2O4/c1-31-16-6-4-14(5-7-16)23(30)29-28-11-13-3-8-19(32-2)15(9-13)12-33-22-20(26)17(24)10-18(25)21(22)27/h3-11H,12H2,1-2H3,(H,29,30)/b28-11+ |
| InChIKey | KRAXBZCIHBHHCS-IPBVOBEMSA-N |
| XLogP | 4.60 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|