C27H18F4O3 — CID 19561191
(E)-3-[4-methoxy-3-[(2,3,5,6-tetrafluorophenoxy)methyl]phenyl]-1-naphthalen-2-ylprop-2-en-1-one (PubChem CID 19561191) has the molecular formula C27H18F4O3 and a molecular weight of 466.43 g/mol. Its IUPAC name is (E)-3-[4-methoxy-3-[(2,3,5,6-tetrafluorophenoxy)methyl]phenyl]-1-naphthalen-2-ylprop-2-en-1-one.
| Compound Name | (E)-3-[4-methoxy-3-[(2,3,5,6-tetrafluorophenoxy)methyl]phenyl]-1-naphthalen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 19561191 |
| Molecular Formula | C27H18F4O3 |
| Molecular Weight | 466.43 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | (E)-3-[4-methoxy-3-[(2,3,5,6-tetrafluorophenoxy)methyl]phenyl]-1-naphthalen-2-ylprop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc3ccccc3c2)cc1COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C27H18F4O3/c1-33-24-11-7-16(6-10-23(32)19-9-8-17-4-2-3-5-18(17)13-19)12-20(24)15-34-27-25(30)21(28)14-22(29)26(27)31/h2-14H,15H2,1H3/b10-6+ |
| InChIKey | PTUWROSTILNGCR-UXBLZVDNSA-N |
| XLogP | 6.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.43 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|