C23H18F4O3S — CID 19556882
(E)-1-(2,5-dimethylthiophen-3-yl)-3-[4-methoxy-3-[(2,3,5,6-tetrafluorophenoxy)methyl]phenyl]prop-2-en-1-one (PubChem CID 19556882) has the molecular formula C23H18F4O3S and a molecular weight of 450.45 g/mol. Its IUPAC name is (E)-1-(2,5-dimethylthiophen-3-yl)-3-[4-methoxy-3-[(2,3,5,6-tetrafluorophenoxy)methyl]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(2,5-dimethylthiophen-3-yl)-3-[4-methoxy-3-[(2,3,5,6-tetrafluorophenoxy)methyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19556882 |
| Molecular Formula | C23H18F4O3S |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | (E)-1-(2,5-dimethylthiophen-3-yl)-3-[4-methoxy-3-[(2,3,5,6-tetrafluorophenoxy)methyl]phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2cc(C)sc2C)cc1COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C23H18F4O3S/c1-12-8-16(13(2)31-12)19(28)6-4-14-5-7-20(29-3)15(9-14)11-30-23-21(26)17(24)10-18(25)22(23)27/h4-10H,11H2,1-3H3/b6-4+ |
| InChIKey | JFGVGKAYPQXSCL-GQCTYLIASA-N |
| XLogP | 6.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|