C23H20Cl2O3S — CID 19556880
(E)-3-[3-[(2,3-dichlorophenoxy)methyl]-4-methoxyphenyl]-1-(2,5-dimethylthiophen-3-yl)prop-2-en-1-one (PubChem CID 19556880) has the molecular formula C23H20Cl2O3S and a molecular weight of 447.38 g/mol. Its IUPAC name is (E)-3-[3-[(2,3-dichlorophenoxy)methyl]-4-methoxyphenyl]-1-(2,5-dimethylthiophen-3-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[3-[(2,3-dichlorophenoxy)methyl]-4-methoxyphenyl]-1-(2,5-dimethylthiophen-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19556880 |
| Molecular Formula | C23H20Cl2O3S |
| Molecular Weight | 447.38 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | (E)-3-[3-[(2,3-dichlorophenoxy)methyl]-4-methoxyphenyl]-1-(2,5-dimethylthiophen-3-yl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2cc(C)sc2C)cc1COc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C23H20Cl2O3S/c1-14-11-18(15(2)29-14)20(26)9-7-16-8-10-21(27-3)17(12-16)13-28-22-6-4-5-19(24)23(22)25/h4-12H,13H2,1-3H3/b9-7+ |
| InChIKey | JGSHLKQWSKHJGO-VQHVLOKHSA-N |
| XLogP | 7.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.38 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|