C23H18Cl2O4 — CID 3919613
3-[3-[(2,4-dichlorophenoxy)methyl]-4-methoxyphenyl]-1-(2-hydroxyphenyl)prop-2-en-1-one (PubChem CID 3919613) has the molecular formula C23H18Cl2O4 and a molecular weight of 429.30 g/mol. Its IUPAC name is 3-[3-[(2,4-dichlorophenoxy)methyl]-4-methoxyphenyl]-1-(2-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | 3-[3-[(2,4-dichlorophenoxy)methyl]-4-methoxyphenyl]-1-(2-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 3919613 |
| Molecular Formula | C23H18Cl2O4 |
| Molecular Weight | 429.30 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 3-[3-[(2,4-dichlorophenoxy)methyl]-4-methoxyphenyl]-1-(2-hydroxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C=CC(=O)c2ccccc2O)cc1COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H18Cl2O4/c1-28-22-10-7-15(6-9-21(27)18-4-2-3-5-20(18)26)12-16(22)14-29-23-11-8-17(24)13-19(23)25/h2-13,26H,14H2,1H3 |
| InChIKey | SRBZODNUWJWOPZ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.30 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|