C29H21Cl2NO3S — CID 19544375
(E)-3-[3-[(2,4-dichlorophenoxy)methyl]-4-methoxyphenyl]-1-(10H-phenothiazin-2-yl)prop-2-en-1-one (PubChem CID 19544375) has the molecular formula C29H21Cl2NO3S and a molecular weight of 534.46 g/mol. Its IUPAC name is (E)-3-[3-[(2,4-dichlorophenoxy)methyl]-4-methoxyphenyl]-1-(10H-phenothiazin-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[3-[(2,4-dichlorophenoxy)methyl]-4-methoxyphenyl]-1-(10H-phenothiazin-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19544375 |
| Molecular Formula | C29H21Cl2NO3S |
| Molecular Weight | 534.46 g/mol |
| Exact Mass | 533.06 |
| IUPAC Name | (E)-3-[3-[(2,4-dichlorophenoxy)methyl]-4-methoxyphenyl]-1-(10H-phenothiazin-2-yl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc3c(c2)Nc2ccccc2S3)cc1COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C29H21Cl2NO3S/c1-34-26-11-7-18(14-20(26)17-35-27-12-9-21(30)16-22(27)31)6-10-25(33)19-8-13-29-24(15-19)32-23-4-2-3-5-28(23)36-29/h2-16,32H,17H2,1H3/b10-6+ |
| InChIKey | JXDBWVKRJOAKGW-UXBLZVDNSA-N |
| XLogP | 8.69 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.46 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|