C27H26N2O2S2 — CID 19544447
(E)-3-[4-methoxy-3-(thiomorpholin-4-ylmethyl)phenyl]-1-(10H-phenothiazin-2-yl)prop-2-en-1-one (PubChem CID 19544447) has the molecular formula C27H26N2O2S2 and a molecular weight of 474.65 g/mol. Its IUPAC name is (E)-3-[4-methoxy-3-(thiomorpholin-4-ylmethyl)phenyl]-1-(10H-phenothiazin-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-methoxy-3-(thiomorpholin-4-ylmethyl)phenyl]-1-(10H-phenothiazin-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19544447 |
| Molecular Formula | C27H26N2O2S2 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | (E)-3-[4-methoxy-3-(thiomorpholin-4-ylmethyl)phenyl]-1-(10H-phenothiazin-2-yl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc3c(c2)Nc2ccccc2S3)cc1CN1CCSCC1 |
| InChI | InChI=1S/C27H26N2O2S2/c1-31-25-10-7-19(16-21(25)18-29-12-14-32-15-13-29)6-9-24(30)20-8-11-27-23(17-20)28-22-4-2-3-5-26(22)33-27/h2-11,16-17,28H,12-15,18H2,1H3/b9-6+ |
| InChIKey | HBPLVVWQEVGQDK-RMKNXTFCSA-N |
| XLogP | 6.35 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|