C23H27NO5 — CID 8830206
(E)-3-(3,4-dimethoxyphenyl)-1-[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]prop-2-en-1-one (PubChem CID 8830206) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-1-[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-1-[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 8830206 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-1-[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2ccc(OC)c(OC)c2)cc1CN1CCOCC1 |
| InChI | InChI=1S/C23H27NO5/c1-26-21-9-6-18(15-19(21)16-24-10-12-29-13-11-24)20(25)7-4-17-5-8-22(27-2)23(14-17)28-3/h4-9,14-15H,10-13,16H2,1-3H3/b7-4+ |
| InChIKey | HHHFKPUAZNLDOL-QPJJXVBHSA-N |
| XLogP | 3.44 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|