C25H30N2O3S — CID 19541482
(E)-3-[4-methoxy-3-(thiomorpholin-4-ylmethyl)phenyl]-1-(4-morpholin-4-ylphenyl)prop-2-en-1-one (PubChem CID 19541482) has the molecular formula C25H30N2O3S and a molecular weight of 438.59 g/mol. Its IUPAC name is (E)-3-[4-methoxy-3-(thiomorpholin-4-ylmethyl)phenyl]-1-(4-morpholin-4-ylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-methoxy-3-(thiomorpholin-4-ylmethyl)phenyl]-1-(4-morpholin-4-ylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19541482 |
| Molecular Formula | C25H30N2O3S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | (E)-3-[4-methoxy-3-(thiomorpholin-4-ylmethyl)phenyl]-1-(4-morpholin-4-ylphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(N3CCOCC3)cc2)cc1CN1CCSCC1 |
| InChI | InChI=1S/C25H30N2O3S/c1-29-25-9-3-20(18-22(25)19-26-12-16-31-17-13-26)2-8-24(28)21-4-6-23(7-5-21)27-10-14-30-15-11-27/h2-9,18H,10-17,19H2,1H3/b8-2+ |
| InChIKey | QDUXIIFPKPUSBD-KRXBUXKQSA-N |
| XLogP | 3.98 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|