C27H22Cl5NO4 — CID 19541448
(E)-3-[4-methoxy-3-[(2,3,4,5,6-pentachlorophenoxy)methyl]phenyl]-1-(4-morpholin-4-ylphenyl)prop-2-en-1-one (PubChem CID 19541448) has the molecular formula C27H22Cl5NO4 and a molecular weight of 601.74 g/mol. Its IUPAC name is (E)-3-[4-methoxy-3-[(2,3,4,5,6-pentachlorophenoxy)methyl]phenyl]-1-(4-morpholin-4-ylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-methoxy-3-[(2,3,4,5,6-pentachlorophenoxy)methyl]phenyl]-1-(4-morpholin-4-ylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19541448 |
| Molecular Formula | C27H22Cl5NO4 |
| Molecular Weight | 601.74 g/mol |
| Exact Mass | 599.00 |
| IUPAC Name | (E)-3-[4-methoxy-3-[(2,3,4,5,6-pentachlorophenoxy)methyl]phenyl]-1-(4-morpholin-4-ylphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(N3CCOCC3)cc2)cc1COc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C27H22Cl5NO4/c1-35-21-9-3-16(14-18(21)15-37-27-25(31)23(29)22(28)24(30)26(27)32)2-8-20(34)17-4-6-19(7-5-17)33-10-12-36-13-11-33/h2-9,14H,10-13,15H2,1H3/b8-2+ |
| InChIKey | WFBHDRDEQFCVMD-KRXBUXKQSA-N |
| XLogP | 8.27 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.74 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|