C23H15Cl5O5 — CID 19540611
(E)-1-(2,4-dihydroxyphenyl)-3-[4-methoxy-3-[(2,3,4,5,6-pentachlorophenoxy)methyl]phenyl]prop-2-en-1-one (PubChem CID 19540611) has the molecular formula C23H15Cl5O5 and a molecular weight of 548.63 g/mol. Its IUPAC name is (E)-1-(2,4-dihydroxyphenyl)-3-[4-methoxy-3-[(2,3,4,5,6-pentachlorophenoxy)methyl]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(2,4-dihydroxyphenyl)-3-[4-methoxy-3-[(2,3,4,5,6-pentachlorophenoxy)methyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19540611 |
| Molecular Formula | C23H15Cl5O5 |
| Molecular Weight | 548.63 g/mol |
| Exact Mass | 545.94 |
| IUPAC Name | (E)-1-(2,4-dihydroxyphenyl)-3-[4-methoxy-3-[(2,3,4,5,6-pentachlorophenoxy)methyl]phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(O)cc2O)cc1COc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C23H15Cl5O5/c1-32-17-7-3-11(2-6-15(30)14-5-4-13(29)9-16(14)31)8-12(17)10-33-23-21(27)19(25)18(24)20(26)22(23)28/h2-9,29,31H,10H2,1H3/b6-2+ |
| InChIKey | IVQMHRRRAIRFJB-QHHAFSJGSA-N |
| XLogP | 7.85 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.63 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|