C24H21NO7 — CID 19571307
(E)-1-(2,4-dihydroxyphenyl)-3-[4-methoxy-3-[(3-methyl-4-nitrophenoxy)methyl]phenyl]prop-2-en-1-one (PubChem CID 19571307) has the molecular formula C24H21NO7 and a molecular weight of 435.43 g/mol. Its IUPAC name is (E)-1-(2,4-dihydroxyphenyl)-3-[4-methoxy-3-[(3-methyl-4-nitrophenoxy)methyl]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(2,4-dihydroxyphenyl)-3-[4-methoxy-3-[(3-methyl-4-nitrophenoxy)methyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19571307 |
| Molecular Formula | C24H21NO7 |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | (E)-1-(2,4-dihydroxyphenyl)-3-[4-methoxy-3-[(3-methyl-4-nitrophenoxy)methyl]phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(O)cc2O)cc1COc1ccc([N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C24H21NO7/c1-15-11-19(6-8-21(15)25(29)30)32-14-17-12-16(4-10-24(17)31-2)3-9-22(27)20-7-5-18(26)13-23(20)28/h3-13,26,28H,14H2,1-2H3/b9-3+ |
| InChIKey | KXYKTYFUARKUFJ-YCRREMRBSA-N |
| XLogP | 4.80 |
| TPSA | 119.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|