C26H26O5 — CID 19568773
(E)-1-(2,5-dimethoxyphenyl)-3-[4-methoxy-3-[(4-methylphenoxy)methyl]phenyl]prop-2-en-1-one (PubChem CID 19568773) has the molecular formula C26H26O5 and a molecular weight of 418.49 g/mol. Its IUPAC name is (E)-1-(2,5-dimethoxyphenyl)-3-[4-methoxy-3-[(4-methylphenoxy)methyl]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(2,5-dimethoxyphenyl)-3-[4-methoxy-3-[(4-methylphenoxy)methyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19568773 |
| Molecular Formula | C26H26O5 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | (E)-1-(2,5-dimethoxyphenyl)-3-[4-methoxy-3-[(4-methylphenoxy)methyl]phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(OC)c(C(=O)/C=C/c2ccc(OC)c(COc3ccc(C)cc3)c2)c1 |
| InChI | InChI=1S/C26H26O5/c1-18-5-9-21(10-6-18)31-17-20-15-19(8-13-25(20)29-3)7-12-24(27)23-16-22(28-2)11-14-26(23)30-4/h5-16H,17H2,1-4H3/b12-7+ |
| InChIKey | CVSBTRGBOGVQPL-KPKJPENVSA-N |
| XLogP | 5.50 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|