C25H24O3 — CID 19564957
(E)-3-[4-methoxy-3-[(2-methylphenoxy)methyl]phenyl]-1-(4-methylphenyl)prop-2-en-1-one (PubChem CID 19564957) has the molecular formula C25H24O3 and a molecular weight of 372.46 g/mol. Its IUPAC name is (E)-3-[4-methoxy-3-[(2-methylphenoxy)methyl]phenyl]-1-(4-methylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-methoxy-3-[(2-methylphenoxy)methyl]phenyl]-1-(4-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19564957 |
| Molecular Formula | C25H24O3 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | (E)-3-[4-methoxy-3-[(2-methylphenoxy)methyl]phenyl]-1-(4-methylphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(C)cc2)cc1COc1ccccc1C |
| InChI | InChI=1S/C25H24O3/c1-18-8-12-21(13-9-18)23(26)14-10-20-11-15-25(27-3)22(16-20)17-28-24-7-5-4-6-19(24)2/h4-16H,17H2,1-3H3/b14-10+ |
| InChIKey | OTEOUQUECHXXJI-GXDHUFHOSA-N |
| XLogP | 5.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|