C27H28O5 — CID 19559421
(E)-1-(3,4-dimethoxyphenyl)-3-[3-[(2,6-dimethylphenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one (PubChem CID 19559421) has the molecular formula C27H28O5 and a molecular weight of 432.52 g/mol. Its IUPAC name is (E)-1-(3,4-dimethoxyphenyl)-3-[3-[(2,6-dimethylphenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(3,4-dimethoxyphenyl)-3-[3-[(2,6-dimethylphenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19559421 |
| Molecular Formula | C27H28O5 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | (E)-1-(3,4-dimethoxyphenyl)-3-[3-[(2,6-dimethylphenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(OC)c(OC)c2)cc1COc1c(C)cccc1C |
| InChI | InChI=1S/C27H28O5/c1-18-7-6-8-19(2)27(18)32-17-22-15-20(10-13-24(22)29-3)9-12-23(28)21-11-14-25(30-4)26(16-21)31-5/h6-16H,17H2,1-5H3/b12-9+ |
| InChIKey | XBASAKNBKRXLGM-FMIVXFBMSA-N |
| XLogP | 5.80 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|