C26H25ClO5 — CID 19561072
(E)-3-[3-[(4-chloro-3-methylphenoxy)methyl]-4-methoxyphenyl]-1-(3,4-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 19561072) has the molecular formula C26H25ClO5 and a molecular weight of 452.93 g/mol. Its IUPAC name is (E)-3-[3-[(4-chloro-3-methylphenoxy)methyl]-4-methoxyphenyl]-1-(3,4-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[3-[(4-chloro-3-methylphenoxy)methyl]-4-methoxyphenyl]-1-(3,4-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19561072 |
| Molecular Formula | C26H25ClO5 |
| Molecular Weight | 452.93 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | (E)-3-[3-[(4-chloro-3-methylphenoxy)methyl]-4-methoxyphenyl]-1-(3,4-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(OC)c(OC)c2)cc1COc1ccc(Cl)c(C)c1 |
| InChI | InChI=1S/C26H25ClO5/c1-17-13-21(8-9-22(17)27)32-16-20-14-18(6-11-24(20)29-2)5-10-23(28)19-7-12-25(30-3)26(15-19)31-4/h5-15H,16H2,1-4H3/b10-5+ |
| InChIKey | YKDCSSAAODEWEF-BJMVGYQFSA-N |
| XLogP | 6.15 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.93 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|