C23H13Cl2F5O3 — CID 19569099
(E)-1-(3,4-dichlorophenyl)-3-[4-methoxy-3-[(2,3,4,5,6-pentafluorophenoxy)methyl]phenyl]prop-2-en-1-one (PubChem CID 19569099) has the molecular formula C23H13Cl2F5O3 and a molecular weight of 503.25 g/mol. Its IUPAC name is (E)-1-(3,4-dichlorophenyl)-3-[4-methoxy-3-[(2,3,4,5,6-pentafluorophenoxy)methyl]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(3,4-dichlorophenyl)-3-[4-methoxy-3-[(2,3,4,5,6-pentafluorophenoxy)methyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19569099 |
| Molecular Formula | C23H13Cl2F5O3 |
| Molecular Weight | 503.25 g/mol |
| Exact Mass | 502.02 |
| IUPAC Name | (E)-1-(3,4-dichlorophenyl)-3-[4-methoxy-3-[(2,3,4,5,6-pentafluorophenoxy)methyl]phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(Cl)c(Cl)c2)cc1COc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C23H13Cl2F5O3/c1-32-17-7-3-11(2-6-16(31)12-4-5-14(24)15(25)9-12)8-13(17)10-33-23-21(29)19(27)18(26)20(28)22(23)30/h2-9H,10H2,1H3/b6-2+ |
| InChIKey | KXGWZLMKSBAWGB-QHHAFSJGSA-N |
| XLogP | 7.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.25 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|