C27H19Cl3O3 — CID 19561137
(E)-3-[4-methoxy-3-[(2,4,6-trichlorophenoxy)methyl]phenyl]-1-naphthalen-2-ylprop-2-en-1-one (PubChem CID 19561137) has the molecular formula C27H19Cl3O3 and a molecular weight of 497.81 g/mol. Its IUPAC name is (E)-3-[4-methoxy-3-[(2,4,6-trichlorophenoxy)methyl]phenyl]-1-naphthalen-2-ylprop-2-en-1-one.
| Compound Name | (E)-3-[4-methoxy-3-[(2,4,6-trichlorophenoxy)methyl]phenyl]-1-naphthalen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 19561137 |
| Molecular Formula | C27H19Cl3O3 |
| Molecular Weight | 497.81 g/mol |
| Exact Mass | 496.04 |
| IUPAC Name | (E)-3-[4-methoxy-3-[(2,4,6-trichlorophenoxy)methyl]phenyl]-1-naphthalen-2-ylprop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc3ccccc3c2)cc1COc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C27H19Cl3O3/c1-32-26-11-7-17(12-21(26)16-33-27-23(29)14-22(28)15-24(27)30)6-10-25(31)20-9-8-18-4-2-3-5-19(18)13-20/h2-15H,16H2,1H3/b10-6+ |
| InChIKey | OKKRBHBXLDFODH-UXBLZVDNSA-N |
| XLogP | 8.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.81 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|