C27H20Cl2O3 — CID 19561136
(E)-3-[3-[(2,4-dichlorophenoxy)methyl]-4-methoxyphenyl]-1-naphthalen-2-ylprop-2-en-1-one (PubChem CID 19561136) has the molecular formula C27H20Cl2O3 and a molecular weight of 463.36 g/mol. Its IUPAC name is (E)-3-[3-[(2,4-dichlorophenoxy)methyl]-4-methoxyphenyl]-1-naphthalen-2-ylprop-2-en-1-one.
| Compound Name | (E)-3-[3-[(2,4-dichlorophenoxy)methyl]-4-methoxyphenyl]-1-naphthalen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 19561136 |
| Molecular Formula | C27H20Cl2O3 |
| Molecular Weight | 463.36 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | (E)-3-[3-[(2,4-dichlorophenoxy)methyl]-4-methoxyphenyl]-1-naphthalen-2-ylprop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc3ccccc3c2)cc1COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H20Cl2O3/c1-31-26-12-7-18(14-22(26)17-32-27-13-10-23(28)16-24(27)29)6-11-25(30)21-9-8-19-4-2-3-5-20(19)15-21/h2-16H,17H2,1H3/b11-6+ |
| InChIKey | LOHJHGVMUFLTBD-IZZDOVSWSA-N |
| XLogP | 7.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.36 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|