C23H17Cl2NO5 — CID 19560972
(E)-3-[3-[(2,4-dichlorophenoxy)methyl]-4-methoxyphenyl]-1-(2-nitrophenyl)prop-2-en-1-one (PubChem CID 19560972) has the molecular formula C23H17Cl2NO5 and a molecular weight of 458.30 g/mol. Its IUPAC name is (E)-3-[3-[(2,4-dichlorophenoxy)methyl]-4-methoxyphenyl]-1-(2-nitrophenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[3-[(2,4-dichlorophenoxy)methyl]-4-methoxyphenyl]-1-(2-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19560972 |
| Molecular Formula | C23H17Cl2NO5 |
| Molecular Weight | 458.30 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | (E)-3-[3-[(2,4-dichlorophenoxy)methyl]-4-methoxyphenyl]-1-(2-nitrophenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccccc2[N+](=O)[O-])cc1COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H17Cl2NO5/c1-30-22-10-7-15(6-9-21(27)18-4-2-3-5-20(18)26(28)29)12-16(22)14-31-23-11-8-17(24)13-19(23)25/h2-13H,14H2,1H3/b9-6+ |
| InChIKey | QIUJAJIRGUCIAO-RMKNXTFCSA-N |
| XLogP | 6.39 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.30 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|