C23H17Cl2FO3 — CID 19564756
(E)-1-(2,4-dichlorophenyl)-3-[3-[(2-fluorophenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one (PubChem CID 19564756) has the molecular formula C23H17Cl2FO3 and a molecular weight of 431.29 g/mol. Its IUPAC name is (E)-1-(2,4-dichlorophenyl)-3-[3-[(2-fluorophenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(2,4-dichlorophenyl)-3-[3-[(2-fluorophenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19564756 |
| Molecular Formula | C23H17Cl2FO3 |
| Molecular Weight | 431.29 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | (E)-1-(2,4-dichlorophenyl)-3-[3-[(2-fluorophenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(Cl)cc2Cl)cc1COc1ccccc1F |
| InChI | InChI=1S/C23H17Cl2FO3/c1-28-22-11-7-15(6-10-21(27)18-9-8-17(24)13-19(18)25)12-16(22)14-29-23-5-3-2-4-20(23)26/h2-13H,14H2,1H3/b10-6+ |
| InChIKey | KTJFCPITJBKTRJ-UXBLZVDNSA-N |
| XLogP | 6.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.29 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|