C23H17ClF2O3 — CID 19551287
(E)-1-(4-chlorophenyl)-3-[3-[(2,4-difluorophenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one (PubChem CID 19551287) has the molecular formula C23H17ClF2O3 and a molecular weight of 414.84 g/mol. Its IUPAC name is (E)-1-(4-chlorophenyl)-3-[3-[(2,4-difluorophenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-chlorophenyl)-3-[3-[(2,4-difluorophenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19551287 |
| Molecular Formula | C23H17ClF2O3 |
| Molecular Weight | 414.84 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | (E)-1-(4-chlorophenyl)-3-[3-[(2,4-difluorophenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(Cl)cc2)cc1COc1ccc(F)cc1F |
| InChI | InChI=1S/C23H17ClF2O3/c1-28-22-10-3-15(2-9-21(27)16-4-6-18(24)7-5-16)12-17(22)14-29-23-11-8-19(25)13-20(23)26/h2-13H,14H2,1H3/b9-2+ |
| InChIKey | UOPNPBNOXXJMQQ-XNWCZRBMSA-N |
| XLogP | 6.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.84 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|