C26H25FO3 — CID 19557412
(E)-3-[3-[(2-fluorophenoxy)methyl]-4-methoxyphenyl]-1-(4-propan-2-ylphenyl)prop-2-en-1-one (PubChem CID 19557412) has the molecular formula C26H25FO3 and a molecular weight of 404.48 g/mol. Its IUPAC name is (E)-3-[3-[(2-fluorophenoxy)methyl]-4-methoxyphenyl]-1-(4-propan-2-ylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[3-[(2-fluorophenoxy)methyl]-4-methoxyphenyl]-1-(4-propan-2-ylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19557412 |
| Molecular Formula | C26H25FO3 |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | (E)-3-[3-[(2-fluorophenoxy)methyl]-4-methoxyphenyl]-1-(4-propan-2-ylphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(C(C)C)cc2)cc1COc1ccccc1F |
| InChI | InChI=1S/C26H25FO3/c1-18(2)20-10-12-21(13-11-20)24(28)14-8-19-9-15-25(29-3)22(16-19)17-30-26-7-5-4-6-23(26)27/h4-16,18H,17H2,1-3H3/b14-8+ |
| InChIKey | DEIDGMFOEWZUPF-RIYZIHGNSA-N |
| XLogP | 6.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|