C26H26O4 — CID 19564810
(E)-1-(4-hydroxyphenyl)-3-[4-methoxy-3-[(4-propan-2-ylphenoxy)methyl]phenyl]prop-2-en-1-one (PubChem CID 19564810) has the molecular formula C26H26O4 and a molecular weight of 402.49 g/mol. Its IUPAC name is (E)-1-(4-hydroxyphenyl)-3-[4-methoxy-3-[(4-propan-2-ylphenoxy)methyl]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-hydroxyphenyl)-3-[4-methoxy-3-[(4-propan-2-ylphenoxy)methyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19564810 |
| Molecular Formula | C26H26O4 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | (E)-1-(4-hydroxyphenyl)-3-[4-methoxy-3-[(4-propan-2-ylphenoxy)methyl]phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(O)cc2)cc1COc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C26H26O4/c1-18(2)20-8-12-24(13-9-20)30-17-22-16-19(5-15-26(22)29-3)4-14-25(28)21-6-10-23(27)11-7-21/h4-16,18,27H,17H2,1-3H3/b14-4+ |
| InChIKey | CJXUBWKXFJVGMQ-LNKIKWGQSA-N |
| XLogP | 6.00 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|