C27H27BrO3 — CID 19541271
(E)-1-(4-bromophenyl)-3-[3-[(4-tert-butylphenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one (PubChem CID 19541271) has the molecular formula C27H27BrO3 and a molecular weight of 479.41 g/mol. Its IUPAC name is (E)-1-(4-bromophenyl)-3-[3-[(4-tert-butylphenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-bromophenyl)-3-[3-[(4-tert-butylphenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19541271 |
| Molecular Formula | C27H27BrO3 |
| Molecular Weight | 479.41 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | (E)-1-(4-bromophenyl)-3-[3-[(4-tert-butylphenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(Br)cc2)cc1COc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C27H27BrO3/c1-27(2,3)22-9-13-24(14-10-22)31-18-21-17-19(6-16-26(21)30-4)5-15-25(29)20-7-11-23(28)12-8-20/h5-17H,18H2,1-4H3/b15-5+ |
| InChIKey | BJALBAMPBRMIPQ-PJQLUOCWSA-N |
| XLogP | 7.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.41 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|