C27H26Cl2O3 — CID 19569088
(E)-3-[3-[(4-tert-butylphenoxy)methyl]-4-methoxyphenyl]-1-(3,4-dichlorophenyl)prop-2-en-1-one (PubChem CID 19569088) has the molecular formula C27H26Cl2O3 and a molecular weight of 469.41 g/mol. Its IUPAC name is (E)-3-[3-[(4-tert-butylphenoxy)methyl]-4-methoxyphenyl]-1-(3,4-dichlorophenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[3-[(4-tert-butylphenoxy)methyl]-4-methoxyphenyl]-1-(3,4-dichlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19569088 |
| Molecular Formula | C27H26Cl2O3 |
| Molecular Weight | 469.41 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | (E)-3-[3-[(4-tert-butylphenoxy)methyl]-4-methoxyphenyl]-1-(3,4-dichlorophenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(Cl)c(Cl)c2)cc1COc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C27H26Cl2O3/c1-27(2,3)21-8-10-22(11-9-21)32-17-20-15-18(6-14-26(20)31-4)5-13-25(30)19-7-12-23(28)24(29)16-19/h5-16H,17H2,1-4H3/b13-5+ |
| InChIKey | NHKVQZSOKKLVHR-WLRTZDKTSA-N |
| XLogP | 7.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.41 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|