C24H21ClO5 — CID 19565124
(E)-3-[3-[(4-chlorophenoxy)methyl]-4-methoxyphenyl]-1-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one (PubChem CID 19565124) has the molecular formula C24H21ClO5 and a molecular weight of 424.88 g/mol. Its IUPAC name is (E)-3-[3-[(4-chlorophenoxy)methyl]-4-methoxyphenyl]-1-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[3-[(4-chlorophenoxy)methyl]-4-methoxyphenyl]-1-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19565124 |
| Molecular Formula | C24H21ClO5 |
| Molecular Weight | 424.88 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | (E)-3-[3-[(4-chlorophenoxy)methyl]-4-methoxyphenyl]-1-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(C(=O)/C=C/c2ccc(OC)c(COc3ccc(Cl)cc3)c2)ccc1O |
| InChI | InChI=1S/C24H21ClO5/c1-28-23-12-4-16(13-18(23)15-30-20-8-6-19(25)7-9-20)3-10-21(26)17-5-11-22(27)24(14-17)29-2/h3-14,27H,15H2,1-2H3/b10-3+ |
| InChIKey | GRWKIWALJHJGKV-XCVCLJGOSA-N |
| XLogP | 5.54 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.88 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|