C25H22Cl2O3 — CID 19569109
(E)-1-(3,4-dichlorophenyl)-3-[3-[(4-ethylphenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one (PubChem CID 19569109) has the molecular formula C25H22Cl2O3 and a molecular weight of 441.35 g/mol. Its IUPAC name is (E)-1-(3,4-dichlorophenyl)-3-[3-[(4-ethylphenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(3,4-dichlorophenyl)-3-[3-[(4-ethylphenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19569109 |
| Molecular Formula | C25H22Cl2O3 |
| Molecular Weight | 441.35 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | (E)-1-(3,4-dichlorophenyl)-3-[3-[(4-ethylphenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one |
| SMILES | CCc1ccc(OCc2cc(/C=C/C(=O)c3ccc(Cl)c(Cl)c3)ccc2OC)cc1 |
| InChI | InChI=1S/C25H22Cl2O3/c1-3-17-4-9-21(10-5-17)30-16-20-14-18(7-13-25(20)29-2)6-12-24(28)19-8-11-22(26)23(27)15-19/h4-15H,3,16H2,1-2H3/b12-6+ |
| InChIKey | AWRFCPUBAVLICJ-WUXMJOGZSA-N |
| XLogP | 7.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.35 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|