C21H25NO3 — CID 170877314
(Z)-3-[3-[(4-tert-butylphenoxy)methyl]-4-methoxyphenyl]prop-2-enamide (PubChem CID 170877314) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is (Z)-3-[3-[(4-tert-butylphenoxy)methyl]-4-methoxyphenyl]prop-2-enamide.
| Compound Name | (Z)-3-[3-[(4-tert-butylphenoxy)methyl]-4-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 170877314 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | (Z)-3-[3-[(4-tert-butylphenoxy)methyl]-4-methoxyphenyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C\C(N)=O)cc1COc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H25NO3/c1-21(2,3)17-7-9-18(10-8-17)25-14-16-13-15(6-12-20(22)23)5-11-19(16)24-4/h5-13H,14H2,1-4H3,(H2,22,23)/b12-6- |
| InChIKey | YWFMJJCRLIEISJ-SDQBBNPISA-N |
| XLogP | 4.07 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|