C24H19BrO5 — CID 19568896
(E)-1-(1,3-benzodioxol-5-yl)-3-[3-[(4-bromophenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one (PubChem CID 19568896) has the molecular formula C24H19BrO5 and a molecular weight of 467.32 g/mol. Its IUPAC name is (E)-1-(1,3-benzodioxol-5-yl)-3-[3-[(4-bromophenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(1,3-benzodioxol-5-yl)-3-[3-[(4-bromophenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19568896 |
| Molecular Formula | C24H19BrO5 |
| Molecular Weight | 467.32 g/mol |
| Exact Mass | 466.04 |
| IUPAC Name | (E)-1-(1,3-benzodioxol-5-yl)-3-[3-[(4-bromophenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc3c(c2)OCO3)cc1COc1ccc(Br)cc1 |
| InChI | InChI=1S/C24H19BrO5/c1-27-22-10-3-16(12-18(22)14-28-20-7-5-19(25)6-8-20)2-9-21(26)17-4-11-23-24(13-17)30-15-29-23/h2-13H,14-15H2,1H3/b9-2+ |
| InChIKey | IOKUMTZCPGPGFB-XNWCZRBMSA-N |
| XLogP | 5.66 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.32 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|