C24H18FNO7 — CID 19568948
(E)-1-(1,3-benzodioxol-5-yl)-3-[3-[(5-fluoro-2-nitrophenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one (PubChem CID 19568948) has the molecular formula C24H18FNO7 and a molecular weight of 451.41 g/mol. Its IUPAC name is (E)-1-(1,3-benzodioxol-5-yl)-3-[3-[(5-fluoro-2-nitrophenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(1,3-benzodioxol-5-yl)-3-[3-[(5-fluoro-2-nitrophenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19568948 |
| Molecular Formula | C24H18FNO7 |
| Molecular Weight | 451.41 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | (E)-1-(1,3-benzodioxol-5-yl)-3-[3-[(5-fluoro-2-nitrophenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc3c(c2)OCO3)cc1COc1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H18FNO7/c1-30-21-8-3-15(2-7-20(27)16-4-9-22-24(11-16)33-14-32-22)10-17(21)13-31-23-12-18(25)5-6-19(23)26(28)29/h2-12H,13-14H2,1H3/b7-2+ |
| InChIKey | RKHITMWKNIUHKF-FARCUNLSSA-N |
| XLogP | 4.95 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.41 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|